C25H23F2NO3 — CID 67418540
[1-[(4-fluorobenzoyl)amino]-4-phenylpentan-3-yl] 4-fluorobenzoate (PubChem CID 67418540) has the molecular formula C25H23F2NO3 and a molecular weight of 423.46 g/mol. Its IUPAC name is [1-[(4-fluorobenzoyl)amino]-4-phenylpentan-3-yl] 4-fluorobenzoate.
| Compound Name | [1-[(4-fluorobenzoyl)amino]-4-phenylpentan-3-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 67418540 |
| Molecular Formula | C25H23F2NO3 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [1-[(4-fluorobenzoyl)amino]-4-phenylpentan-3-yl] 4-fluorobenzoate |
| SMILES | CC(c1ccccc1)C(CCNC(=O)c1ccc(F)cc1)OC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H23F2NO3/c1-17(18-5-3-2-4-6-18)23(31-25(30)20-9-13-22(27)14-10-20)15-16-28-24(29)19-7-11-21(26)12-8-19/h2-14,17,23H,15-16H2,1H3,(H,28,29) |
| InChIKey | GYEJVOAIPQHQFG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |