C24H34N4O5S — CID 67421157
tert-butyl 2-[[6-oxo-6-(4-sulfamoylanilino)hexyl]-(pyridin-2-ylmethyl)amino]acetate (PubChem CID 67421157) has the molecular formula C24H34N4O5S and a molecular weight of 490.63 g/mol. Its IUPAC name is tert-butyl 2-[[6-oxo-6-(4-sulfamoylanilino)hexyl]-(pyridin-2-ylmethyl)amino]acetate.
| Compound Name | tert-butyl 2-[[6-oxo-6-(4-sulfamoylanilino)hexyl]-(pyridin-2-ylmethyl)amino]acetate |
|---|---|
| PubChem CID | 67421157 |
| Molecular Formula | C24H34N4O5S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | tert-butyl 2-[[6-oxo-6-(4-sulfamoylanilino)hexyl]-(pyridin-2-ylmethyl)amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(CCCCCC(=O)Nc1ccc(S(N)(=O)=O)cc1)Cc1ccccn1 |
| InChI | InChI=1S/C24H34N4O5S/c1-24(2,3)33-23(30)18-28(17-20-9-6-7-15-26-20)16-8-4-5-10-22(29)27-19-11-13-21(14-12-19)34(25,31)32/h6-7,9,11-15H,4-5,8,10,16-18H2,1-3H3,(H,27,29)(H2,25,31,32) |
| InChIKey | ADAYXCQYEDFKHE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 131.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|