About 2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethanol
2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethanol (PubChem CID 67424827) has the molecular formula C8H9NO2S
and a molecular weight of 183.23 g/mol. Its IUPAC name is 2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethanol.
Analyze 2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethanol?
The IUPAC name of 2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethanol (CID 67424827) is 2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethanol.
What is the SMILES notation for 2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethanol?
The canonical SMILES for 2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethanol is OCc1cc2c(cn1)OCCS2.
What is the InChIKey of 2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethanol?
The InChIKey is MLWMVTSIHUDRLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2S/c10-5-6-3-8-7(4-9-6)11-1-2-12-8/h3-4,10H,1-2,5H2.
What are the key properties of 2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethanol?
2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethanol has a molecular weight of 183.23 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethanol is sourced from PubChem (CID 67424827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).