C23H34N4O3 — CID 67425922
tert-butyl N-[2-(7,7-dimethyl-6-oxo-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-2-yl)ethyl]carbamate (PubChem CID 67425922) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is tert-butyl N-[2-(7,7-dimethyl-6-oxo-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(7,7-dimethyl-6-oxo-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 67425922 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | tert-butyl N-[2-(7,7-dimethyl-6-oxo-5-pentyl-1H-pyrrolo[2,3-f]benzimidazol-2-yl)ethyl]carbamate |
| SMILES | CCCCCN1C(=O)C(C)(C)c2cc3[nH]c(CCNC(=O)OC(C)(C)C)nc3cc21 |
| InChI | InChI=1S/C23H34N4O3/c1-7-8-9-12-27-18-14-17-16(13-15(18)23(5,6)20(27)28)25-19(26-17)10-11-24-21(29)30-22(2,3)4/h13-14H,7-12H2,1-6H3,(H,24,29)(H,25,26) |
| InChIKey | QMBUBYAGRKQTAA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|