C27H28F2N4O3 — CID 67427393
2-tert-butyl-4-[[4-(2-cyclopropylethynyl)-9-fluoro-1-oxo-2H-benzo[c][1,6]naphthyridin-6-yl]amino]-3-fluoropiperidine-1-carboxylic acid (PubChem CID 67427393) has the molecular formula C27H28F2N4O3 and a molecular weight of 494.54 g/mol. Its IUPAC name is 2-tert-butyl-4-[[4-(2-cyclopropylethynyl)-9-fluoro-1-oxo-2H-benzo[c][1,6]naphthyridin-6-yl]amino]-3-fluoropiperidine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-[[4-(2-cyclopropylethynyl)-9-fluoro-1-oxo-2H-benzo[c][1,6]naphthyridin-6-yl]amino]-3-fluoropiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67427393 |
| Molecular Formula | C27H28F2N4O3 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 2-tert-butyl-4-[[4-(2-cyclopropylethynyl)-9-fluoro-1-oxo-2H-benzo[c][1,6]naphthyridin-6-yl]amino]-3-fluoropiperidine-1-carboxylic acid |
| SMILES | CC(C)(C)C1C(F)C(Nc2nc3c(C#CC4CC4)c[nH]c(=O)c3c3cc(F)ccc23)CCN1C(=O)O |
| InChI | InChI=1S/C27H28F2N4O3/c1-27(2,3)23-21(29)19(10-11-33(23)26(35)36)31-24-17-9-8-16(28)12-18(17)20-22(32-24)15(13-30-25(20)34)7-6-14-4-5-14/h8-9,12-14,19,21,23H,4-5,10-11H2,1-3H3,(H,30,34)(H,31,32)(H,35,36) |
| InChIKey | OFWFMUZTCIKGBU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|