C8H13F3N4O2 — CID 67427616
3,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 67427616) has the molecular formula C8H13F3N4O2 and a molecular weight of 254.21 g/mol. Its IUPAC name is 3,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 3,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67427616 |
| Molecular Formula | C8H13F3N4O2 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 3,5,6,7,8,8a-hexahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | NC1=NC2CCCCN2N1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H12N4.C2HF3O2/c7-6-8-5-3-1-2-4-10(5)9-6;3-2(4,5)1(6)7/h5H,1-4H2,(H3,7,8,9);(H,6,7) |
| InChIKey | FYDVCKSTWRBHNP-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |