C27H32N8O5 — CID 67428894
tert-butyl 2-[[2-(diethylamino)-5-nitropyrimidin-4-yl]amino]-3-[4-(2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)phenyl]propanoate (PubChem CID 67428894) has the molecular formula C27H32N8O5 and a molecular weight of 548.60 g/mol. Its IUPAC name is tert-butyl 2-[[2-(diethylamino)-5-nitropyrimidin-4-yl]amino]-3-[4-(2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)phenyl]propanoate.
| Compound Name | tert-butyl 2-[[2-(diethylamino)-5-nitropyrimidin-4-yl]amino]-3-[4-(2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 67428894 |
| Molecular Formula | C27H32N8O5 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | tert-butyl 2-[[2-(diethylamino)-5-nitropyrimidin-4-yl]amino]-3-[4-(2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)phenyl]propanoate |
| SMILES | CCN(CC)c1ncc([N+](=O)[O-])c(NC(Cc2ccc(-n3c(=O)[nH]c4cccnc43)cc2)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C27H32N8O5/c1-6-33(7-2)25-29-16-21(35(38)39)22(32-25)30-20(24(36)40-27(3,4)5)15-17-10-12-18(13-11-17)34-23-19(31-26(34)37)9-8-14-28-23/h8-14,16,20H,6-7,15H2,1-5H3,(H,31,37)(H,29,30,32) |
| InChIKey | YTPJGQYXWAPKGM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 161.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|