C15H26N2O4 — CID 67431243
(2S,4R)-2-tert-butyl-2-(dimethylcarbamoyl)-4-prop-2-enoxypyrrolidine-1-carboxylic acid (PubChem CID 67431243) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is (2S,4R)-2-tert-butyl-2-(dimethylcarbamoyl)-4-prop-2-enoxypyrrolidine-1-carboxylic acid.
| Compound Name | (2S,4R)-2-tert-butyl-2-(dimethylcarbamoyl)-4-prop-2-enoxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67431243 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (2S,4R)-2-tert-butyl-2-(dimethylcarbamoyl)-4-prop-2-enoxypyrrolidine-1-carboxylic acid |
| SMILES | C=CCO[C@H]1CN(C(=O)O)[C@](C(=O)N(C)C)(C(C)(C)C)C1 |
| InChI | InChI=1S/C15H26N2O4/c1-7-8-21-11-9-15(14(2,3)4,12(18)16(5)6)17(10-11)13(19)20/h7,11H,1,8-10H2,2-6H3,(H,19,20)/t11-,15-/m1/s1 |
| InChIKey | CWWUARKHHUEGKI-IAQYHMDHSA-N |
| XLogP | 1.81 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|