C17H28N2O6 — CID 70072161
2-O'-tert-butyl 2-O-methyl (2S)-1-[(2S)-2-aminopropanoyl]-4-prop-2-enoxypyrrolidine-2,2-dicarboxylate (PubChem CID 70072161) has the molecular formula C17H28N2O6 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-O'-tert-butyl 2-O-methyl (2S)-1-[(2S)-2-aminopropanoyl]-4-prop-2-enoxypyrrolidine-2,2-dicarboxylate.
| Compound Name | 2-O'-tert-butyl 2-O-methyl (2S)-1-[(2S)-2-aminopropanoyl]-4-prop-2-enoxypyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 70072161 |
| Molecular Formula | C17H28N2O6 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 2-O'-tert-butyl 2-O-methyl (2S)-1-[(2S)-2-aminopropanoyl]-4-prop-2-enoxypyrrolidine-2,2-dicarboxylate |
| SMILES | C=CCOC1CN(C(=O)[C@H](C)N)[C@@](C(=O)OC)(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H28N2O6/c1-7-8-24-12-9-17(14(21)23-6,15(22)25-16(3,4)5)19(10-12)13(20)11(2)18/h7,11-12H,1,8-10,18H2,2-6H3/t11-,12?,17-/m0/s1 |
| InChIKey | JISBXECUXLLXHJ-HSLAMFCZSA-N |
| XLogP | 0.39 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|