C16H19N3O5 — CID 67437305
3-(1-hydroxy-4-nitro-2,3-dihydroisoindol-1-yl)-3-propylpiperidine-2,6-dione (PubChem CID 67437305) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 3-(1-hydroxy-4-nitro-2,3-dihydroisoindol-1-yl)-3-propylpiperidine-2,6-dione.
| Compound Name | 3-(1-hydroxy-4-nitro-2,3-dihydroisoindol-1-yl)-3-propylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 67437305 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 3-(1-hydroxy-4-nitro-2,3-dihydroisoindol-1-yl)-3-propylpiperidine-2,6-dione |
| SMILES | CCCC1(C2(O)NCc3c([N+](=O)[O-])cccc32)CCC(=O)NC1=O |
| InChI | InChI=1S/C16H19N3O5/c1-2-7-15(8-6-13(20)18-14(15)21)16(22)11-4-3-5-12(19(23)24)10(11)9-17-16/h3-5,17,22H,2,6-9H2,1H3,(H,18,20,21) |
| InChIKey | HWOMOXMCOHHOCZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|