C18H21N5O2 — CID 67441085
3-pyrimidin-2-yl-4-(1,2,3,4-tetrahydroisoquinolin-7-yl)piperazine-2-carboxylic acid (PubChem CID 67441085) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-pyrimidin-2-yl-4-(1,2,3,4-tetrahydroisoquinolin-7-yl)piperazine-2-carboxylic acid.
| Compound Name | 3-pyrimidin-2-yl-4-(1,2,3,4-tetrahydroisoquinolin-7-yl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 67441085 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 3-pyrimidin-2-yl-4-(1,2,3,4-tetrahydroisoquinolin-7-yl)piperazine-2-carboxylic acid |
| SMILES | O=C(O)C1NCCN(c2ccc3c(c2)CNCC3)C1c1ncccn1 |
| InChI | InChI=1S/C18H21N5O2/c24-18(25)15-16(17-21-5-1-6-22-17)23(9-8-20-15)14-3-2-12-4-7-19-11-13(12)10-14/h1-3,5-6,10,15-16,19-20H,4,7-9,11H2,(H,24,25) |
| InChIKey | AJBKAYRHABOYFN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|