C20H26N2O3 — CID 674442
(4S)-4-hydroxy-4-methyl-3-[2-(2-methyl-1H-indol-3-yl)ethyl]-1-oxa-3-azaspiro[4.5]decan-2-one (PubChem CID 674442) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is (4S)-4-hydroxy-4-methyl-3-[2-(2-methyl-1H-indol-3-yl)ethyl]-1-oxa-3-azaspiro[4.5]decan-2-one.
| Compound Name | (4S)-4-hydroxy-4-methyl-3-[2-(2-methyl-1H-indol-3-yl)ethyl]-1-oxa-3-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 674442 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (4S)-4-hydroxy-4-methyl-3-[2-(2-methyl-1H-indol-3-yl)ethyl]-1-oxa-3-azaspiro[4.5]decan-2-one |
| SMILES | Cc1[nH]c2ccccc2c1CCN1C(=O)OC2(CCCCC2)[C@]1(C)O |
| InChI | InChI=1S/C20H26N2O3/c1-14-15(16-8-4-5-9-17(16)21-14)10-13-22-18(23)25-20(19(22,2)24)11-6-3-7-12-20/h4-5,8-9,21,24H,3,6-7,10-13H2,1-2H3/t19-/m0/s1 |
| InChIKey | MGASALLCUBLWSO-IBGZPJMESA-N |
| XLogP | 3.88 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|