C52H86N4O4 — CID 67451693
(E)-1-[4-[3-(dibutylamino)propoxy]phenyl]-3-[4-[[(E)-1-[4-[3-(dibutylamino)propoxy]phenyl]-1-oxohept-2-en-3-yl]amino]butylamino]hept-2-en-1-one (PubChem CID 67451693) has the molecular formula C52H86N4O4 and a molecular weight of 831.28 g/mol. Its IUPAC name is (E)-1-[4-[3-(dibutylamino)propoxy]phenyl]-3-[4-[[(E)-1-[4-[3-(dibutylamino)propoxy]phenyl]-1-oxohept-2-en-3-yl]amino]butylamino]hept-2-en-1-one.
| Compound Name | (E)-1-[4-[3-(dibutylamino)propoxy]phenyl]-3-[4-[[(E)-1-[4-[3-(dibutylamino)propoxy]phenyl]-1-oxohept-2-en-3-yl]amino]butylamino]hept-2-en-1-one |
|---|---|
| PubChem CID | 67451693 |
| Molecular Formula | C52H86N4O4 |
| Molecular Weight | 831.28 g/mol |
| Exact Mass | 830.66 |
| IUPAC Name | (E)-1-[4-[3-(dibutylamino)propoxy]phenyl]-3-[4-[[(E)-1-[4-[3-(dibutylamino)propoxy]phenyl]-1-oxohept-2-en-3-yl]amino]butylamino]hept-2-en-1-one |
| SMILES | CCCC/C(=C\C(=O)c1ccc(OCCCN(CCCC)CCCC)cc1)NCCCCN/C(=C/C(=O)c1ccc(OCCCN(CCCC)CCCC)cc1)CCCC |
| InChI | InChI=1S/C52H86N4O4/c1-7-13-23-47(43-51(57)45-25-29-49(30-26-45)59-41-21-39-55(35-15-9-3)36-16-10-4)53-33-19-20-34-54-48(24-14-8-2)44-52(58)46-27-31-50(32-28-46)60-42-22-40-56(37-17-11-5)38-18-12-6/h25-32,43-44,53-54H,7-24,33-42H2,1-6H3/b47-43+,48-44+ |
| InChIKey | SEQJRHMQVKBUQY-FOXIJYENSA-N |
| XLogP | 12.20 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.28 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|