About CID 67453842
CID 67453842 (PubChem CID 67453842) has the molecular formula C8H8OSi
and a molecular weight of 148.24 g/mol.
Molecular Properties
| Compound Name | CID 67453842 |
| PubChem CID | 67453842 |
| Molecular Formula | C8H8OSi |
| Molecular Weight | 148.24 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | — |
| SMILES | C=C[Si]c1ccccc1O |
| InChI | InChI=1S/C8H8OSi/c1-2-10-8-6-4-3-5-7(8)9/h2-6,9H,1H2 |
| InChIKey | CIWNBDRKTQYBCX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67453842 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67453842?
The IUPAC name of CID 67453842 (CID 67453842) is not available.
What is the SMILES notation for CID 67453842?
The canonical SMILES for CID 67453842 is C=C[Si]c1ccccc1O.
What is the InChIKey of CID 67453842?
The InChIKey is CIWNBDRKTQYBCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8OSi/c1-2-10-8-6-4-3-5-7(8)9/h2-6,9H,1H2.
What are the key properties of CID 67453842?
CID 67453842 has a molecular weight of 148.24 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67453842 is sourced from PubChem (CID 67453842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).