C14H18Br2S — CID 67460155
2,5-dibromo-3-dec-3-ynylthiophene (PubChem CID 67460155) has the molecular formula C14H18Br2S and a molecular weight of 378.17 g/mol. Its IUPAC name is 2,5-dibromo-3-dec-3-ynylthiophene.
| Compound Name | 2,5-dibromo-3-dec-3-ynylthiophene |
|---|---|
| PubChem CID | 67460155 |
| Molecular Formula | C14H18Br2S |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 2,5-dibromo-3-dec-3-ynylthiophene |
| SMILES | CCCCCCC#CCCc1cc(Br)sc1Br |
| InChI | InChI=1S/C14H18Br2S/c1-2-3-4-5-6-7-8-9-10-12-11-13(15)17-14(12)16/h11H,2-6,9-10H2,1H3 |
| InChIKey | LOAHGTBMJWWGJW-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|