C15H24Br2OS — CID 101496328
11-(2,5-dibromothiophen-3-yl)undecan-1-ol (PubChem CID 101496328) has the molecular formula C15H24Br2OS and a molecular weight of 412.23 g/mol. Its IUPAC name is 11-(2,5-dibromothiophen-3-yl)undecan-1-ol.
| Compound Name | 11-(2,5-dibromothiophen-3-yl)undecan-1-ol |
|---|---|
| PubChem CID | 101496328 |
| Molecular Formula | C15H24Br2OS |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 11-(2,5-dibromothiophen-3-yl)undecan-1-ol |
| SMILES | OCCCCCCCCCCCc1cc(Br)sc1Br |
| InChI | InChI=1S/C15H24Br2OS/c16-14-12-13(15(17)19-14)10-8-6-4-2-1-3-5-7-9-11-18/h12,18H,1-11H2 |
| InChIKey | DFNZMJMCOUQYBP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|