C7H9Br2NS — CID 139824397
2-(2,5-dibromothiophen-3-yl)-N-methylethanamine (PubChem CID 139824397) has the molecular formula C7H9Br2NS and a molecular weight of 299.03 g/mol. Its IUPAC name is 2-(2,5-dibromothiophen-3-yl)-N-methylethanamine.
| Compound Name | 2-(2,5-dibromothiophen-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 139824397 |
| Molecular Formula | C7H9Br2NS |
| Molecular Weight | 299.03 g/mol |
| Exact Mass | 296.88 |
| IUPAC Name | 2-(2,5-dibromothiophen-3-yl)-N-methylethanamine |
| SMILES | CNCCc1cc(Br)sc1Br |
| InChI | InChI=1S/C7H9Br2NS/c1-10-3-2-5-4-6(8)11-7(5)9/h4,10H,2-3H2,1H3 |
| InChIKey | RVSLSNHPLNOPQY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.03 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |