C11H16Br2O3S — CID 162368553
2,5-dibromo-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]thiophene (PubChem CID 162368553) has the molecular formula C11H16Br2O3S and a molecular weight of 388.12 g/mol. Its IUPAC name is 2,5-dibromo-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]thiophene.
| Compound Name | 2,5-dibromo-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]thiophene |
|---|---|
| PubChem CID | 162368553 |
| Molecular Formula | C11H16Br2O3S |
| Molecular Weight | 388.12 g/mol |
| Exact Mass | 385.92 |
| IUPAC Name | 2,5-dibromo-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]thiophene |
| SMILES | COCCOCCOCCc1cc(Br)sc1Br |
| InChI | InChI=1S/C11H16Br2O3S/c1-14-4-5-16-7-6-15-3-2-9-8-10(12)17-11(9)13/h8H,2-7H2,1H3 |
| InChIKey | AGEAKEPANJVKBZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.12 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|