C10H14Br2OS — CID 86013367
6-(2,5-dibromothiophen-3-yl)hexan-1-ol (PubChem CID 86013367) has the molecular formula C10H14Br2OS and a molecular weight of 342.10 g/mol. Its IUPAC name is 6-(2,5-dibromothiophen-3-yl)hexan-1-ol.
| Compound Name | 6-(2,5-dibromothiophen-3-yl)hexan-1-ol |
|---|---|
| PubChem CID | 86013367 |
| Molecular Formula | C10H14Br2OS |
| Molecular Weight | 342.10 g/mol |
| Exact Mass | 339.91 |
| IUPAC Name | 6-(2,5-dibromothiophen-3-yl)hexan-1-ol |
| SMILES | OCCCCCCc1cc(Br)sc1Br |
| InChI | InChI=1S/C10H14Br2OS/c11-9-7-8(10(12)14-9)5-3-1-2-4-6-13/h7,13H,1-6H2 |
| InChIKey | FCGYDWDEDYEMON-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.10 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|