C26H48BrNO5 — CID 67463238
1-(diethylamino)ethyl 7-[(1R,2R)-3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate;hydrobromide (PubChem CID 67463238) has the molecular formula C26H48BrNO5 and a molecular weight of 534.58 g/mol. Its IUPAC name is 1-(diethylamino)ethyl 7-[(1R,2R)-3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate;hydrobromide.
| Compound Name | 1-(diethylamino)ethyl 7-[(1R,2R)-3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate;hydrobromide |
|---|---|
| PubChem CID | 67463238 |
| Molecular Formula | C26H48BrNO5 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 1-(diethylamino)ethyl 7-[(1R,2R)-3-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoate;hydrobromide |
| SMILES | Br.CCCCCC(O)/C=C/[C@H]1C(O)CC(=O)[C@@H]1CCCCCCC(=O)OC(C)N(CC)CC |
| InChI | InChI=1S/C26H47NO5.BrH/c1-5-8-11-14-21(28)17-18-23-22(24(29)19-25(23)30)15-12-9-10-13-16-26(31)32-20(4)27(6-2)7-3;/h17-18,20-23,25,28,30H,5-16,19H2,1-4H3;1H/b18-17+;/t20?,21?,22-,23-,25?;/m1./s1 |
| InChIKey | OWYFVNMWEDCUGJ-LBXLQQDLSA-N |
| XLogP | 5.20 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|