C18H15NO5 — CID 67464500
(3R)-3-methoxy-4-oxo-4-(2-phenyl-1,3-benzoxazol-6-yl)butanoic acid (PubChem CID 67464500) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is (3R)-3-methoxy-4-oxo-4-(2-phenyl-1,3-benzoxazol-6-yl)butanoic acid.
| Compound Name | (3R)-3-methoxy-4-oxo-4-(2-phenyl-1,3-benzoxazol-6-yl)butanoic acid |
|---|---|
| PubChem CID | 67464500 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (3R)-3-methoxy-4-oxo-4-(2-phenyl-1,3-benzoxazol-6-yl)butanoic acid |
| SMILES | CO[C@H](CC(=O)O)C(=O)c1ccc2nc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C18H15NO5/c1-23-15(10-16(20)21)17(22)12-7-8-13-14(9-12)24-18(19-13)11-5-3-2-4-6-11/h2-9,15H,10H2,1H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | VKYWGPDMLRTHAX-OAHLLOKOSA-N |
| XLogP | 3.17 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |