C11H8FN3O4S — CID 67466533
[fluoro(1,3-thiazol-2-yl)methyl]-(2-nitrophenyl)carbamic acid (PubChem CID 67466533) has the molecular formula C11H8FN3O4S and a molecular weight of 297.27 g/mol. Its IUPAC name is [fluoro(1,3-thiazol-2-yl)methyl]-(2-nitrophenyl)carbamic acid.
| Compound Name | [fluoro(1,3-thiazol-2-yl)methyl]-(2-nitrophenyl)carbamic acid |
|---|---|
| PubChem CID | 67466533 |
| Molecular Formula | C11H8FN3O4S |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | [fluoro(1,3-thiazol-2-yl)methyl]-(2-nitrophenyl)carbamic acid |
| SMILES | O=C(O)N(c1ccccc1[N+](=O)[O-])C(F)c1nccs1 |
| InChI | InChI=1S/C11H8FN3O4S/c12-9(10-13-5-6-20-10)14(11(16)17)7-3-1-2-4-8(7)15(18)19/h1-6,9H,(H,16,17) |
| InChIKey | BLRMCOPXJBPIMZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|