C25H30ClN5O2S — CID 67469254
tert-butyl 8-[1-chloro-4-(4-methyl-1,3-thiazol-2-yl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate (PubChem CID 67469254) has the molecular formula C25H30ClN5O2S and a molecular weight of 500.07 g/mol. Its IUPAC name is tert-butyl 8-[1-chloro-4-(4-methyl-1,3-thiazol-2-yl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate.
| Compound Name | tert-butyl 8-[1-chloro-4-(4-methyl-1,3-thiazol-2-yl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 67469254 |
| Molecular Formula | C25H30ClN5O2S |
| Molecular Weight | 500.07 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | tert-butyl 8-[1-chloro-4-(4-methyl-1,3-thiazol-2-yl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate |
| SMILES | Cc1csc(C2CCC(Cl)(c3ccc4c(c3)CN(C(=O)OC(C)(C)C)Cc3nncn3-4)CC2)n1 |
| InChI | InChI=1S/C25H30ClN5O2S/c1-16-14-34-22(28-16)17-7-9-25(26,10-8-17)19-5-6-20-18(11-19)12-30(23(32)33-24(2,3)4)13-21-29-27-15-31(20)21/h5-6,11,14-15,17H,7-10,12-13H2,1-4H3 |
| InChIKey | XQBYPWABXCPSRF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.07 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|