C27H29ClN6O3 — CID 67464462
tert-butyl 8-[1-chloro-4-([1,2]oxazolo[4,5-b]pyridin-3-yl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate (PubChem CID 67464462) has the molecular formula C27H29ClN6O3 and a molecular weight of 521.02 g/mol. Its IUPAC name is tert-butyl 8-[1-chloro-4-([1,2]oxazolo[4,5-b]pyridin-3-yl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate.
| Compound Name | tert-butyl 8-[1-chloro-4-([1,2]oxazolo[4,5-b]pyridin-3-yl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 67464462 |
| Molecular Formula | C27H29ClN6O3 |
| Molecular Weight | 521.02 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | tert-butyl 8-[1-chloro-4-([1,2]oxazolo[4,5-b]pyridin-3-yl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2cc(C3(Cl)CCC(c4noc5cccnc45)CC3)ccc2-n2cnnc2C1 |
| InChI | InChI=1S/C27H29ClN6O3/c1-26(2,3)36-25(35)33-14-18-13-19(6-7-20(18)34-16-30-31-22(34)15-33)27(28)10-8-17(9-11-27)23-24-21(37-32-23)5-4-12-29-24/h4-7,12-13,16-17H,8-11,14-15H2,1-3H3 |
| InChIKey | WLYMZGFCIZJIQV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.02 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|