C27H30ClFN4O3 — CID 67421296
tert-butyl 8-[1-chloro-4-(2-fluorophenoxy)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate (PubChem CID 67421296) has the molecular formula C27H30ClFN4O3 and a molecular weight of 513.01 g/mol. Its IUPAC name is tert-butyl 8-[1-chloro-4-(2-fluorophenoxy)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate.
| Compound Name | tert-butyl 8-[1-chloro-4-(2-fluorophenoxy)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 67421296 |
| Molecular Formula | C27H30ClFN4O3 |
| Molecular Weight | 513.01 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | tert-butyl 8-[1-chloro-4-(2-fluorophenoxy)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2cc(C3(Cl)CCC(Oc4ccccc4F)CC3)ccc2-n2cnnc2C1 |
| InChI | InChI=1S/C27H30ClFN4O3/c1-26(2,3)36-25(34)32-15-18-14-19(8-9-22(18)33-17-30-31-24(33)16-32)27(28)12-10-20(11-13-27)35-23-7-5-4-6-21(23)29/h4-9,14,17,20H,10-13,15-16H2,1-3H3 |
| InChIKey | IOMJJBKSTILUMK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.01 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|