C25H30ClN5O3S — CID 90450545
tert-butyl [8-chloro-1-[4-(4-methyl-1,3-thiazol-2-yl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl] carbonate (PubChem CID 90450545) has the molecular formula C25H30ClN5O3S and a molecular weight of 516.07 g/mol. Its IUPAC name is tert-butyl [8-chloro-1-[4-(4-methyl-1,3-thiazol-2-yl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl] carbonate.
| Compound Name | tert-butyl [8-chloro-1-[4-(4-methyl-1,3-thiazol-2-yl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl] carbonate |
|---|---|
| PubChem CID | 90450545 |
| Molecular Formula | C25H30ClN5O3S |
| Molecular Weight | 516.07 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | tert-butyl [8-chloro-1-[4-(4-methyl-1,3-thiazol-2-yl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-yl] carbonate |
| SMILES | Cc1csc(C2CCC(c3nnc4n3-c3ccc(Cl)cc3CN(OC(=O)OC(C)(C)C)C4)CC2)n1 |
| InChI | InChI=1S/C25H30ClN5O3S/c1-15-14-35-23(27-15)17-7-5-16(6-8-17)22-29-28-21-13-30(34-24(32)33-25(2,3)4)12-18-11-19(26)9-10-20(18)31(21)22/h9-11,14,16-17H,5-8,12-13H2,1-4H3 |
| InChIKey | NXCOJYAUBPQJIH-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.07 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |