C18H21NO5 — CID 67473501
methyl 2-(1,3-dihydroxypropan-2-ylamino)-5-phenylmethoxybenzoate (PubChem CID 67473501) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is methyl 2-(1,3-dihydroxypropan-2-ylamino)-5-phenylmethoxybenzoate.
| Compound Name | methyl 2-(1,3-dihydroxypropan-2-ylamino)-5-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 67473501 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | methyl 2-(1,3-dihydroxypropan-2-ylamino)-5-phenylmethoxybenzoate |
| SMILES | COC(=O)c1cc(OCc2ccccc2)ccc1NC(CO)CO |
| InChI | InChI=1S/C18H21NO5/c1-23-18(22)16-9-15(24-12-13-5-3-2-4-6-13)7-8-17(16)19-14(10-20)11-21/h2-9,14,19-21H,10-12H2,1H3 |
| InChIKey | FYKXUYLRHYGUNJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|