C40H55N3O6Si — CID 67478519
butyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-5-[hydroxy(diphenyl)silyl]-5-methylhexanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate (PubChem CID 67478519) has the molecular formula C40H55N3O6Si and a molecular weight of 701.98 g/mol. Its IUPAC name is butyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-5-[hydroxy(diphenyl)silyl]-5-methylhexanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate.
| Compound Name | butyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-5-[hydroxy(diphenyl)silyl]-5-methylhexanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 67478519 |
| Molecular Formula | C40H55N3O6Si |
| Molecular Weight | 701.98 g/mol |
| Exact Mass | 701.39 |
| IUPAC Name | butyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-5-[hydroxy(diphenyl)silyl]-5-methylhexanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate |
| SMILES | CCCCOC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(C)(C)[Si](O)(c1ccccc1)c1ccccc1)NC(C)=O |
| InChI | InChI=1S/C40H55N3O6Si/c1-7-8-26-49-39(47)36(28-31-18-12-9-13-19-31)43-38(46)35(27-29(2)3)42-37(45)34(41-30(4)44)24-25-40(5,6)50(48,32-20-14-10-15-21-32)33-22-16-11-17-23-33/h9-23,29,34-36,48H,7-8,24-28H2,1-6H3,(H,41,44)(H,42,45)(H,43,46)/t34-,35-,36-/m0/s1 |
| InChIKey | KYJSTWGBEJCOPN-KVBYWJEESA-N |
| XLogP | 4.41 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.98 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|