C29H45N3O10P+ — CID 67478295
[(2R,3S)-3-[[(2S)-2-[[(2S)-2-acetamido-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-4-butoxy-4-oxobutan-2-yl]oxycarbonyloxymethoxy-methyl-oxophosphanium (PubChem CID 67478295) has the molecular formula C29H45N3O10P+ and a molecular weight of 626.66 g/mol. Its IUPAC name is [(2R,3S)-3-[[(2S)-2-[[(2S)-2-acetamido-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-4-butoxy-4-oxobutan-2-yl]oxycarbonyloxymethoxy-methyl-oxophosphanium.
| Compound Name | [(2R,3S)-3-[[(2S)-2-[[(2S)-2-acetamido-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-4-butoxy-4-oxobutan-2-yl]oxycarbonyloxymethoxy-methyl-oxophosphanium |
|---|---|
| PubChem CID | 67478295 |
| Molecular Formula | C29H45N3O10P+ |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | [(2R,3S)-3-[[(2S)-2-[[(2S)-2-acetamido-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-4-butoxy-4-oxobutan-2-yl]oxycarbonyloxymethoxy-methyl-oxophosphanium |
| SMILES | CCCCOC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCc1ccccc1)NC(C)=O)[C@@H](C)OC(=O)OCO[P+](C)=O |
| InChI | InChI=1S/C29H44N3O10P/c1-7-8-16-39-28(36)25(20(4)42-29(37)40-18-41-43(6)38)32-27(35)24(17-19(2)3)31-26(34)23(30-21(5)33)15-14-22-12-10-9-11-13-22/h9-13,19-20,23-25H,7-8,14-18H2,1-6H3,(H2-,30,31,32,33,34,35)/p+1/t20-,23+,24+,25+/m1/s1 |
| InChIKey | UGCQNDOUNMEXKB-OCFYOKIWSA-O |
| XLogP | 3.37 |
| TPSA | 175.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|