C45H57N3O6Si — CID 59706043
benzyl (2S,3S)-2-[[(2S)-2-[[(2S)-2-acetamido-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-[tert-butyl(diphenyl)silyl]oxybutanoate (PubChem CID 59706043) has the molecular formula C45H57N3O6Si and a molecular weight of 764.05 g/mol. Its IUPAC name is benzyl (2S,3S)-2-[[(2S)-2-[[(2S)-2-acetamido-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-[tert-butyl(diphenyl)silyl]oxybutanoate.
| Compound Name | benzyl (2S,3S)-2-[[(2S)-2-[[(2S)-2-acetamido-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-[tert-butyl(diphenyl)silyl]oxybutanoate |
|---|---|
| PubChem CID | 59706043 |
| Molecular Formula | C45H57N3O6Si |
| Molecular Weight | 764.05 g/mol |
| Exact Mass | 763.40 |
| IUPAC Name | benzyl (2S,3S)-2-[[(2S)-2-[[(2S)-2-acetamido-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-[tert-butyl(diphenyl)silyl]oxybutanoate |
| SMILES | CC(=O)N[C@@H](CCc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)OCc1ccccc1)[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C45H57N3O6Si/c1-32(2)30-40(47-42(50)39(46-34(4)49)29-28-35-20-12-8-13-21-35)43(51)48-41(44(52)53-31-36-22-14-9-15-23-36)33(3)54-55(45(5,6)7,37-24-16-10-17-25-37)38-26-18-11-19-27-38/h8-27,32-33,39-41H,28-31H2,1-7H3,(H,46,49)(H,47,50)(H,48,51)/t33-,39-,40-,41-/m0/s1 |
| InChIKey | KEOKDQYNBNCVTL-CBZYVIQQSA-N |
| XLogP | 5.85 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.05 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|