C15H20F3N3O — CID 67480079
2-amino-1-[4-[N-methyl-2-(trifluoromethyl)anilino]piperidin-1-yl]ethanone (PubChem CID 67480079) has the molecular formula C15H20F3N3O and a molecular weight of 315.34 g/mol. Its IUPAC name is 2-amino-1-[4-[N-methyl-2-(trifluoromethyl)anilino]piperidin-1-yl]ethanone.
| Compound Name | 2-amino-1-[4-[N-methyl-2-(trifluoromethyl)anilino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 67480079 |
| Molecular Formula | C15H20F3N3O |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-amino-1-[4-[N-methyl-2-(trifluoromethyl)anilino]piperidin-1-yl]ethanone |
| SMILES | CN(c1ccccc1C(F)(F)F)C1CCN(C(=O)CN)CC1 |
| InChI | InChI=1S/C15H20F3N3O/c1-20(11-6-8-21(9-7-11)14(22)10-19)13-5-3-2-4-12(13)15(16,17)18/h2-5,11H,6-10,19H2,1H3 |
| InChIKey | SFYYEFCAGKWVGZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |