C21H23F3O — CID 67484387
(2S)-2-cyclohexyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]ethanol (PubChem CID 67484387) has the molecular formula C21H23F3O and a molecular weight of 348.41 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]ethanol.
| Compound Name | (2S)-2-cyclohexyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]ethanol |
|---|---|
| PubChem CID | 67484387 |
| Molecular Formula | C21H23F3O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (2S)-2-cyclohexyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]ethanol |
| SMILES | OC[C@H](c1ccc(-c2ccc(C(F)(F)F)cc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C21H23F3O/c22-21(23,24)19-12-10-16(11-13-19)15-6-8-18(9-7-15)20(14-25)17-4-2-1-3-5-17/h6-13,17,20,25H,1-5,14H2/t20-/m0/s1 |
| InChIKey | DXRZAZLZYCLDEE-FQEVSTJZSA-N |
| XLogP | 6.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |