C13H12N4O3S2 — CID 67486748
7-[(4-methyl-1,3-thiazol-2-yl)sulfonylamino]-1H-indole-2-carboxamide (PubChem CID 67486748) has the molecular formula C13H12N4O3S2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 7-[(4-methyl-1,3-thiazol-2-yl)sulfonylamino]-1H-indole-2-carboxamide.
| Compound Name | 7-[(4-methyl-1,3-thiazol-2-yl)sulfonylamino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 67486748 |
| Molecular Formula | C13H12N4O3S2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 7-[(4-methyl-1,3-thiazol-2-yl)sulfonylamino]-1H-indole-2-carboxamide |
| SMILES | Cc1csc(S(=O)(=O)Nc2cccc3cc(C(N)=O)[nH]c23)n1 |
| InChI | InChI=1S/C13H12N4O3S2/c1-7-6-21-13(15-7)22(19,20)17-9-4-2-3-8-5-10(12(14)18)16-11(8)9/h2-6,16-17H,1H3,(H2,14,18) |
| InChIKey | HWNMJVWRWCFXKU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |