C19H26N2O3S — CID 67492643
tert-butyl N-[[5-(5-ethyl-6-methoxy-2-methyl-3-pyridinyl)thiophen-2-yl]methyl]carbamate (PubChem CID 67492643) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is tert-butyl N-[[5-(5-ethyl-6-methoxy-2-methyl-3-pyridinyl)thiophen-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(5-ethyl-6-methoxy-2-methyl-3-pyridinyl)thiophen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 67492643 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | tert-butyl N-[[5-(5-ethyl-6-methoxy-2-methyl-3-pyridinyl)thiophen-2-yl]methyl]carbamate |
| SMILES | CCc1cc(-c2ccc(CNC(=O)OC(C)(C)C)s2)c(C)nc1OC |
| InChI | InChI=1S/C19H26N2O3S/c1-7-13-10-15(12(2)21-17(13)23-6)16-9-8-14(25-16)11-20-18(22)24-19(3,4)5/h8-10H,7,11H2,1-6H3,(H,20,22) |
| InChIKey | FUCUAOVYUXOYRI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |