C23H34N6O6 — CID 67495488
methyl N-[(2S)-3-methyl-1-[(2S)-2-methyl-2-[(3R)-3-methyl-4-(5-nitro-2-pyridinyl)piperazine-1-carbonyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate (PubChem CID 67495488) has the molecular formula C23H34N6O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-[(2S)-2-methyl-2-[(3R)-3-methyl-4-(5-nitro-2-pyridinyl)piperazine-1-carbonyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-[(2S)-2-methyl-2-[(3R)-3-methyl-4-(5-nitro-2-pyridinyl)piperazine-1-carbonyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 67495488 |
| Molecular Formula | C23H34N6O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-[(2S)-2-methyl-2-[(3R)-3-methyl-4-(5-nitro-2-pyridinyl)piperazine-1-carbonyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@@]1(C)C(=O)N1CCN(c2ccc([N+](=O)[O-])cn2)[C@H](C)C1)C(C)C |
| InChI | InChI=1S/C23H34N6O6/c1-15(2)19(25-22(32)35-5)20(30)28-10-6-9-23(28,4)21(31)26-11-12-27(16(3)14-26)18-8-7-17(13-24-18)29(33)34/h7-8,13,15-16,19H,6,9-12,14H2,1-5H3,(H,25,32)/t16-,19+,23+/m1/s1 |
| InChIKey | CQRYJNMACKSAHQ-ICPLQIHGSA-N |
| XLogP | 1.79 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|