C25H29N5O2 — CID 67502011
4-[(2-hydroxy-1-phenylethyl)amino]-6-(4-piperidin-1-ylanilino)pyridine-3-carboxamide (PubChem CID 67502011) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 4-[(2-hydroxy-1-phenylethyl)amino]-6-(4-piperidin-1-ylanilino)pyridine-3-carboxamide.
| Compound Name | 4-[(2-hydroxy-1-phenylethyl)amino]-6-(4-piperidin-1-ylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67502011 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 4-[(2-hydroxy-1-phenylethyl)amino]-6-(4-piperidin-1-ylanilino)pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2ccc(N3CCCCC3)cc2)cc1NC(CO)c1ccccc1 |
| InChI | InChI=1S/C25H29N5O2/c26-25(32)21-16-27-24(15-22(21)29-23(17-31)18-7-3-1-4-8-18)28-19-9-11-20(12-10-19)30-13-5-2-6-14-30/h1,3-4,7-12,15-16,23,31H,2,5-6,13-14,17H2,(H2,26,32)(H2,27,28,29) |
| InChIKey | CEXUVUGMASITSO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|