C25H27N5O3 — CID 90703579
N-[3-[[5-formyl-4-[(2-hydroxy-1-phenylethyl)amino]-2-pyridinyl]amino]phenyl]pyrrolidine-1-carboxamide (PubChem CID 90703579) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[3-[[5-formyl-4-[(2-hydroxy-1-phenylethyl)amino]-2-pyridinyl]amino]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[5-formyl-4-[(2-hydroxy-1-phenylethyl)amino]-2-pyridinyl]amino]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 90703579 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[3-[[5-formyl-4-[(2-hydroxy-1-phenylethyl)amino]-2-pyridinyl]amino]phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=Cc1cnc(Nc2cccc(NC(=O)N3CCCC3)c2)cc1NC(CO)c1ccccc1 |
| InChI | InChI=1S/C25H27N5O3/c31-16-19-15-26-24(14-22(19)29-23(17-32)18-7-2-1-3-8-18)27-20-9-6-10-21(13-20)28-25(33)30-11-4-5-12-30/h1-3,6-10,13-16,23,32H,4-5,11-12,17H2,(H,28,33)(H2,26,27,29) |
| InChIKey | MNAZEDBUCXOUEM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|