C22H21N5O2 — CID 166399749
5-phenyl-N-[3-(pyrrolidine-1-carbonylamino)phenyl]pyrazine-2-carboxamide (PubChem CID 166399749) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 5-phenyl-N-[3-(pyrrolidine-1-carbonylamino)phenyl]pyrazine-2-carboxamide.
| Compound Name | 5-phenyl-N-[3-(pyrrolidine-1-carbonylamino)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 166399749 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 5-phenyl-N-[3-(pyrrolidine-1-carbonylamino)phenyl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)N2CCCC2)c1)c1cnc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C22H21N5O2/c28-21(20-15-23-19(14-24-20)16-7-2-1-3-8-16)25-17-9-6-10-18(13-17)26-22(29)27-11-4-5-12-27/h1-3,6-10,13-15H,4-5,11-12H2,(H,25,28)(H,26,29) |
| InChIKey | OJWMSOHGKMLYMI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |