C29H40N6O8 — CID 67502778
(4S,4aS,5aR,12aR)-9-[(tert-butylcarbamoylamino)-methylamino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67502778) has the molecular formula C29H40N6O8 and a molecular weight of 600.67 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-9-[(tert-butylcarbamoylamino)-methylamino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-9-[(tert-butylcarbamoylamino)-methylamino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67502778 |
| Molecular Formula | C29H40N6O8 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-[(tert-butylcarbamoylamino)-methylamino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(N(C)NC(=O)NC(C)(C)C)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H40N6O8/c1-28(2,3)31-27(42)32-35(8)16-11-15(33(4)5)13-9-12-10-14-20(34(6)7)23(38)19(26(30)41)25(40)29(14,43)24(39)17(12)22(37)18(13)21(16)36/h11-12,14,20,36-37,40,43H,9-10H2,1-8H3,(H2,30,41)(H2,31,32,42)/t12-,14-,20-,29-/m0/s1 |
| InChIKey | PLNKHRKGSBWFNR-LPVWHBIISA-N |
| XLogP | 0.48 |
| TPSA | 209.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|