C22H24BN5O2 — CID 67504312
4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl-(1,2,4-triazol-4-yl)amino]benzonitrile (PubChem CID 67504312) has the molecular formula C22H24BN5O2 and a molecular weight of 401.28 g/mol. Its IUPAC name is 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl-(1,2,4-triazol-4-yl)amino]benzonitrile.
| Compound Name | 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl-(1,2,4-triazol-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 67504312 |
| Molecular Formula | C22H24BN5O2 |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl-(1,2,4-triazol-4-yl)amino]benzonitrile |
| SMILES | CC1(C)OB(c2ccc(CN(c3ccc(C#N)cc3)n3cnnc3)cc2)OC1(C)C |
| InChI | InChI=1S/C22H24BN5O2/c1-21(2)22(3,4)30-23(29-21)19-9-5-18(6-10-19)14-28(27-15-25-26-16-27)20-11-7-17(13-24)8-12-20/h5-12,15-16H,14H2,1-4H3 |
| InChIKey | PJIKVVOVWOSRMJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 76.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|