C20H28ClNO5 — CID 67504384
methyl 2-[[(Z)-1-(2-chlorophenoxy)-3-ethoxy-3-oxoprop-1-enyl]amino]-5,5-dimethylhexanoate (PubChem CID 67504384) has the molecular formula C20H28ClNO5 and a molecular weight of 397.90 g/mol. Its IUPAC name is methyl 2-[[(Z)-1-(2-chlorophenoxy)-3-ethoxy-3-oxoprop-1-enyl]amino]-5,5-dimethylhexanoate.
| Compound Name | methyl 2-[[(Z)-1-(2-chlorophenoxy)-3-ethoxy-3-oxoprop-1-enyl]amino]-5,5-dimethylhexanoate |
|---|---|
| PubChem CID | 67504384 |
| Molecular Formula | C20H28ClNO5 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | methyl 2-[[(Z)-1-(2-chlorophenoxy)-3-ethoxy-3-oxoprop-1-enyl]amino]-5,5-dimethylhexanoate |
| SMILES | CCOC(=O)/C=C(/NC(CCC(C)(C)C)C(=O)OC)Oc1ccccc1Cl |
| InChI | InChI=1S/C20H28ClNO5/c1-6-26-18(23)13-17(27-16-10-8-7-9-14(16)21)22-15(19(24)25-5)11-12-20(2,3)4/h7-10,13,15,22H,6,11-12H2,1-5H3/b17-13- |
| InChIKey | XUAGOGPYPPJXIF-LGMDPLHJSA-N |
| XLogP | 4.08 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|