C58H72N2O4 — CID 67506351
2-(2-adamantyl)-6-amino-3-[2,4-bis(1-adamantyl)-5-[2-(2-adamantyl)-4-amino-3-hydroxyphenoxy]phenoxy]phenol (PubChem CID 67506351) has the molecular formula C58H72N2O4 and a molecular weight of 861.22 g/mol. Its IUPAC name is 2-(2-adamantyl)-6-amino-3-[2,4-bis(1-adamantyl)-5-[2-(2-adamantyl)-4-amino-3-hydroxyphenoxy]phenoxy]phenol.
| Compound Name | 2-(2-adamantyl)-6-amino-3-[2,4-bis(1-adamantyl)-5-[2-(2-adamantyl)-4-amino-3-hydroxyphenoxy]phenoxy]phenol |
|---|---|
| PubChem CID | 67506351 |
| Molecular Formula | C58H72N2O4 |
| Molecular Weight | 861.22 g/mol |
| Exact Mass | 860.55 |
| IUPAC Name | 2-(2-adamantyl)-6-amino-3-[2,4-bis(1-adamantyl)-5-[2-(2-adamantyl)-4-amino-3-hydroxyphenoxy]phenoxy]phenol |
| SMILES | Nc1ccc(Oc2cc(Oc3ccc(N)c(O)c3C3C4CC5CC(C4)CC3C5)c(C34CC5CC(CC(C5)C3)C4)cc2C23CC4CC(CC(C4)C2)C3)c(C2C3CC4CC(C3)CC2C4)c1O |
| InChI | InChI=1S/C58H72N2O4/c59-45-1-3-47(53(55(45)61)51-39-13-29-5-30(15-39)16-40(51)14-29)63-49-22-50(64-48-4-2-46(60)56(62)54(48)52-41-17-31-6-32(19-41)20-42(52)18-31)44(58-26-36-10-37(27-58)12-38(11-36)28-58)21-43(49)57-23-33-7-34(24-57)9-35(8-33)25-57/h1-4,21-22,29-42,51-52,61-62H,5-20,23-28,59-60H2 |
| InChIKey | ICWWIDPFWYEUAP-UHFFFAOYSA-N |
| XLogP | 13.86 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.22 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|