About 5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole
5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole (PubChem CID 67507483) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole.
Molecular Properties
| Compound Name | 5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole |
| PubChem CID | 67507483 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole |
| SMILES | COc1cccc2c1Cc1cn(C)nc1-2 |
| InChI | InChI=1S/C12H12N2O/c1-14-7-8-6-10-9(12(8)13-14)4-3-5-11(10)15-2/h3-5,7H,6H2,1-2H3 |
| InChIKey | ULCJCLHBCXOKIA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole?
The IUPAC name of 5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole (CID 67507483) is 5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole.
What is the SMILES notation for 5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole?
The canonical SMILES for 5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole is COc1cccc2c1Cc1cn(C)nc1-2.
What is the InChIKey of 5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole?
The InChIKey is ULCJCLHBCXOKIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O/c1-14-7-8-6-10-9(12(8)13-14)4-3-5-11(10)15-2/h3-5,7H,6H2,1-2H3.
What are the key properties of 5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole?
5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole has a molecular weight of 200.24 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-methyl-4H-indeno[1,2-c]pyrazole is sourced from PubChem (CID 67507483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).