C17H11BrClNO3S — CID 67512563
methyl 4-bromo-2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]benzoate (PubChem CID 67512563) has the molecular formula C17H11BrClNO3S and a molecular weight of 424.70 g/mol. Its IUPAC name is methyl 4-bromo-2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]benzoate.
| Compound Name | methyl 4-bromo-2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 67512563 |
| Molecular Formula | C17H11BrClNO3S |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 422.93 |
| IUPAC Name | methyl 4-bromo-2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Br)cc1NC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C17H11BrClNO3S/c1-23-17(22)10-7-6-9(18)8-12(10)20-16(21)15-14(19)11-4-2-3-5-13(11)24-15/h2-8H,1H3,(H,20,21) |
| InChIKey | XGVXUGOJCFTDKL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |