C23H15Cl2NO3S — CID 67512466
methyl 2-chloro-4-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-5-phenylbenzoate (PubChem CID 67512466) has the molecular formula C23H15Cl2NO3S and a molecular weight of 456.35 g/mol. Its IUPAC name is methyl 2-chloro-4-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-5-phenylbenzoate.
| Compound Name | methyl 2-chloro-4-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-5-phenylbenzoate |
|---|---|
| PubChem CID | 67512466 |
| Molecular Formula | C23H15Cl2NO3S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | methyl 2-chloro-4-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-5-phenylbenzoate |
| SMILES | COC(=O)c1cc(-c2ccccc2)c(NC(=O)c2sc3ccccc3c2Cl)cc1Cl |
| InChI | InChI=1S/C23H15Cl2NO3S/c1-29-23(28)16-11-15(13-7-3-2-4-8-13)18(12-17(16)24)26-22(27)21-20(25)14-9-5-6-10-19(14)30-21/h2-12H,1H3,(H,26,27) |
| InChIKey | CMFWLZHJOQCUHH-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |