C22H13Cl2NO3S — CID 155549305
2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-4-(2-chlorophenyl)benzoic acid (PubChem CID 155549305) has the molecular formula C22H13Cl2NO3S and a molecular weight of 442.32 g/mol. Its IUPAC name is 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-4-(2-chlorophenyl)benzoic acid.
| Compound Name | 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-4-(2-chlorophenyl)benzoic acid |
|---|---|
| PubChem CID | 155549305 |
| Molecular Formula | C22H13Cl2NO3S |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-4-(2-chlorophenyl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccccc2Cl)cc1NC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C22H13Cl2NO3S/c23-16-7-3-1-5-13(16)12-9-10-14(22(27)28)17(11-12)25-21(26)20-19(24)15-6-2-4-8-18(15)29-20/h1-11H,(H,25,26)(H,27,28) |
| InChIKey | VHYJZJBSSRHIGR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |