C20H25ClN4O4S — CID 67527892
N-[4-(chloromethyl)-2-(2-methoxyethylcarbamoyl)phenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide (PubChem CID 67527892) has the molecular formula C20H25ClN4O4S and a molecular weight of 452.96 g/mol. Its IUPAC name is N-[4-(chloromethyl)-2-(2-methoxyethylcarbamoyl)phenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-(chloromethyl)-2-(2-methoxyethylcarbamoyl)phenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 67527892 |
| Molecular Formula | C20H25ClN4O4S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N-[4-(chloromethyl)-2-(2-methoxyethylcarbamoyl)phenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide |
| SMILES | COCCNC(=O)c1cc(CCl)ccc1NC(=O)c1csc(N2CC[C@H](OC)C2)n1 |
| InChI | InChI=1S/C20H25ClN4O4S/c1-28-8-6-22-18(26)15-9-13(10-21)3-4-16(15)23-19(27)17-12-30-20(24-17)25-7-5-14(11-25)29-2/h3-4,9,12,14H,5-8,10-11H2,1-2H3,(H,22,26)(H,23,27)/t14-/m0/s1 |
| InChIKey | MBJBXJLEVPULQR-AWEZNQCLSA-N |
| XLogP | 2.74 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|