C20H24ClFN4O3S — CID 89134020
N-[4-(chloromethyl)-2-(3-fluoropropylcarbamoyl)phenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide (PubChem CID 89134020) has the molecular formula C20H24ClFN4O3S and a molecular weight of 454.96 g/mol. Its IUPAC name is N-[4-(chloromethyl)-2-(3-fluoropropylcarbamoyl)phenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-(chloromethyl)-2-(3-fluoropropylcarbamoyl)phenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 89134020 |
| Molecular Formula | C20H24ClFN4O3S |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | N-[4-(chloromethyl)-2-(3-fluoropropylcarbamoyl)phenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CO[C@H]1CCN(c2nc(C(=O)Nc3ccc(CCl)cc3C(=O)NCCCF)cs2)C1 |
| InChI | InChI=1S/C20H24ClFN4O3S/c1-29-14-5-8-26(11-14)20-25-17(12-30-20)19(28)24-16-4-3-13(10-21)9-15(16)18(27)23-7-2-6-22/h3-4,9,12,14H,2,5-8,10-11H2,1H3,(H,23,27)(H,24,28)/t14-/m0/s1 |
| InChIKey | XVVDNFIDSFOULR-AWEZNQCLSA-N |
| XLogP | 3.45 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|