C21H27ClN4O3S — CID 89134004
N-[4-(2-chloroethyl)-2-(propylcarbamoyl)phenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide (PubChem CID 89134004) has the molecular formula C21H27ClN4O3S and a molecular weight of 450.99 g/mol. Its IUPAC name is N-[4-(2-chloroethyl)-2-(propylcarbamoyl)phenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-(2-chloroethyl)-2-(propylcarbamoyl)phenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 89134004 |
| Molecular Formula | C21H27ClN4O3S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-[4-(2-chloroethyl)-2-(propylcarbamoyl)phenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCNC(=O)c1cc(CCCl)ccc1NC(=O)c1csc(N2CC[C@H](OC)C2)n1 |
| InChI | InChI=1S/C21H27ClN4O3S/c1-3-9-23-19(27)16-11-14(6-8-22)4-5-17(16)24-20(28)18-13-30-21(25-18)26-10-7-15(12-26)29-2/h4-5,11,13,15H,3,6-10,12H2,1-2H3,(H,23,27)(H,24,28)/t15-/m0/s1 |
| InChIKey | WUMBWCLWJFDSSQ-HNNXBMFYSA-N |
| XLogP | 3.54 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|