C23H31N5O4S — CID 70956759
N-[2-(2-methoxyethylcarbamoyl)-4-pyrrolidin-3-ylphenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide (PubChem CID 70956759) has the molecular formula C23H31N5O4S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-[2-(2-methoxyethylcarbamoyl)-4-pyrrolidin-3-ylphenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(2-methoxyethylcarbamoyl)-4-pyrrolidin-3-ylphenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 70956759 |
| Molecular Formula | C23H31N5O4S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | N-[2-(2-methoxyethylcarbamoyl)-4-pyrrolidin-3-ylphenyl]-2-[(3S)-3-methoxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide |
| SMILES | COCCNC(=O)c1cc(C2CCNC2)ccc1NC(=O)c1csc(N2CC[C@H](OC)C2)n1 |
| InChI | InChI=1S/C23H31N5O4S/c1-31-10-8-25-21(29)18-11-15(16-5-7-24-12-16)3-4-19(18)26-22(30)20-14-33-23(27-20)28-9-6-17(13-28)32-2/h3-4,11,14,16-17,24H,5-10,12-13H2,1-2H3,(H,25,29)(H,26,30)/t16?,17-/m0/s1 |
| InChIKey | VXIMOXMDQJJDEM-DJNXLDHESA-N |
| XLogP | 2.07 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|